C15H23NO9 — CID 70974433
[4,6-diacetyloxy-3-hydroxy-5-(propanoylamino)oxan-2-yl]methyl acetate (PubChem CID 70974433) has the molecular formula C15H23NO9 and a molecular weight of 361.35 g/mol. Its IUPAC name is [4,6-diacetyloxy-3-hydroxy-5-(propanoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [4,6-diacetyloxy-3-hydroxy-5-(propanoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70974433 |
| Molecular Formula | C15H23NO9 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [4,6-diacetyloxy-3-hydroxy-5-(propanoylamino)oxan-2-yl]methyl acetate |
| SMILES | CCC(=O)NC1C(OC(C)=O)OC(COC(C)=O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C15H23NO9/c1-5-11(20)16-12-14(23-8(3)18)13(21)10(6-22-7(2)17)25-15(12)24-9(4)19/h10,12-15,21H,5-6H2,1-4H3,(H,16,20) |
| InChIKey | WFJOHMGTADIMLS-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|