C16H22N4O10 — CID 71311754
[(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 71311754) has the molecular formula C16H22N4O10 and a molecular weight of 430.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71311754 |
| Molecular Formula | C16H22N4O10 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](NC(=O)CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22N4O10/c1-7(21)26-6-11-14(27-8(2)22)15(28-9(3)23)13(16(30-11)29-10(4)24)19-12(25)5-18-20-17/h11,13-16H,5-6H2,1-4H3,(H,19,25)/t11-,13-,14+,15-,16?/m1/s1 |
| InChIKey | HGMISDAXLUIXKM-YJUJGKJLSA-N |
| XLogP | -0.50 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|