C13H17NO7S2 — CID 123521750
(6,7-diacetyloxy-2-sulfanylidene-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate (PubChem CID 123521750) has the molecular formula C13H17NO7S2 and a molecular weight of 363.41 g/mol. Its IUPAC name is (6,7-diacetyloxy-2-sulfanylidene-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate.
| Compound Name | (6,7-diacetyloxy-2-sulfanylidene-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate |
|---|---|
| PubChem CID | 123521750 |
| Molecular Formula | C13H17NO7S2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (6,7-diacetyloxy-2-sulfanylidene-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate |
| SMILES | CC(=O)OCC1SC2OC(=S)NC2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C13H17NO7S2/c1-5(15)18-4-8-10(19-6(2)16)11(20-7(3)17)9-12(23-8)21-13(22)14-9/h8-12H,4H2,1-3H3,(H,14,22) |
| InChIKey | PJGIEBKRJMSGFP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|