C20H31IN6O2 — CID 111643315
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111643315) has the molecular formula C20H31IN6O2 and a molecular weight of 514.41 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111643315 |
| Molecular Formula | C20H31IN6O2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(-n2cncn2)cc1.I |
| InChI | InChI=1S/C20H30N6O2.HI/c1-21-20(23-9-2-10-28-14-18-7-11-27-12-8-18)24-13-17-3-5-19(6-4-17)26-16-22-15-25-26;/h3-6,15-16,18H,2,7-14H2,1H3,(H2,21,23,24);1H |
| InChIKey | POKPYXHZHWJJTR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|