C19H29FN6O — CID 111650976
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine (PubChem CID 111650976) has the molecular formula C19H29FN6O and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111650976 |
| Molecular Formula | C19H29FN6O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCc1ccc(-n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C19H29FN6O/c1-21-19(23-8-10-25(2)9-4-12-27-3)24-14-16-5-6-18(17(20)13-16)26-11-7-22-15-26/h5-7,11,13,15H,4,8-10,12,14H2,1-3H3,(H2,21,23,24) |
| InChIKey | QJTUJYAZJGOPTE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|