C21H48O2Si3 — CID 11165972
[(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenepentyl]-trimethylsilane (PubChem CID 11165972) has the molecular formula C21H48O2Si3 and a molecular weight of 416.87 g/mol. Its IUPAC name is [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenepentyl]-trimethylsilane.
| Compound Name | [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenepentyl]-trimethylsilane |
|---|---|
| PubChem CID | 11165972 |
| Molecular Formula | C21H48O2Si3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenepentyl]-trimethylsilane |
| SMILES | C=C(C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C21H48O2Si3/c1-18(17-24(8,9)10)15-19(23-26(13,14)21(5,6)7)16-22-25(11,12)20(2,3)4/h19H,1,15-17H2,2-14H3/t19-/m1/s1 |
| InChIKey | LGQDXSOAULISAR-LJQANCHMSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|