C21H29N3O4 — CID 111661875
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine (PubChem CID 111661875) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111661875 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C21H29N3O4/c1-5-22-20(24-13-21(4,25)17-10-14(2)27-15(17)3)23-11-16-12-26-18-8-6-7-9-19(18)28-16/h6-10,16,25H,5,11-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | YCQQGOWGBNKXBH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|