C21H28FN3O2 — CID 111661851
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]guanidine (PubChem CID 111661851) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]guanidine.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 111661851 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NC1CC1c1ccccc1F |
| InChI | InChI=1S/C21H28FN3O2/c1-5-23-20(24-12-21(4,26)17-10-13(2)27-14(17)3)25-19-11-16(19)15-8-6-7-9-18(15)22/h6-10,16,19,26H,5,11-12H2,1-4H3,(H2,23,24,25) |
| InChIKey | PRSZPUKFOWCKLB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|