C24H35IN4O4 — CID 111662136
N-cyclopropyl-2-[3-[[[[[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111662136) has the molecular formula C24H35IN4O4 and a molecular weight of 570.47 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[[[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[3-[[[[[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111662136 |
| Molecular Formula | C24H35IN4O4 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[[[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]amino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)NC2CC2)c1)NCC(C)(O)c1cc(C)oc1C.I |
| InChI | InChI=1S/C24H34N4O4.HI/c1-5-25-23(27-15-24(4,30)21-11-16(2)32-17(21)3)26-13-18-7-6-8-20(12-18)31-14-22(29)28-19-9-10-19;/h6-8,11-12,19,30H,5,9-10,13-15H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | NCQZKGJKYSPTLV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|