C19H38N4O4 — CID 111667758
tert-butyl N-[3-[[ethylamino-[3-(oxan-4-yloxy)propylamino]methylidene]amino]propyl]carbamate (PubChem CID 111667758) has the molecular formula C19H38N4O4 and a molecular weight of 386.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[3-(oxan-4-yloxy)propylamino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[3-(oxan-4-yloxy)propylamino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111667758 |
| Molecular Formula | C19H38N4O4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[3-(oxan-4-yloxy)propylamino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCCOC1CCOCC1 |
| InChI | InChI=1S/C19H38N4O4/c1-5-20-17(21-10-6-11-23-18(24)27-19(2,3)4)22-12-7-13-26-16-8-14-25-15-9-16/h16H,5-15H2,1-4H3,(H,23,24)(H2,20,21,22) |
| InChIKey | UOCJZTVHHJMINP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|