C16H24F2N6O — CID 111674674
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111674674) has the molecular formula C16H24F2N6O and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111674674 |
| Molecular Formula | C16H24F2N6O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCC(CC)c1cc(CN/C(=N/C)NCc2nccn2C(F)F)on1 |
| InChI | InChI=1S/C16H24F2N6O/c1-4-11(5-2)13-8-12(25-23-13)9-21-16(19-3)22-10-14-20-6-7-24(14)15(17)18/h6-8,11,15H,4-5,9-10H2,1-3H3,(H2,19,21,22) |
| InChIKey | UWJZEUPUFSPWDY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|