C17H29IN6O — CID 111674945
1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111674945) has the molecular formula C17H29IN6O and a molecular weight of 460.36 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111674945 |
| Molecular Formula | C17H29IN6O |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N/C)NCCCn2ccnc2)on1.I |
| InChI | InChI=1S/C17H28N6O.HI/c1-4-14(5-2)16-11-15(24-22-16)12-21-17(18-3)20-7-6-9-23-10-8-19-13-23;/h8,10-11,13-14H,4-7,9,12H2,1-3H3,(H2,18,20,21);1H |
| InChIKey | XCVYIVQXJMTNLD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|