C23H35ClIN5O2 — CID 111676015
1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111676015) has the molecular formula C23H35ClIN5O2 and a molecular weight of 575.92 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111676015 |
| Molecular Formula | C23H35ClIN5O2 |
| Molecular Weight | 575.92 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCC(c2ccc(Cl)cc2)N2CCOCC2)on1.I |
| InChI | InChI=1S/C23H34ClN5O2.HI/c1-4-17(5-2)21-14-20(31-28-21)15-26-23(25-3)27-16-22(29-10-12-30-13-11-29)18-6-8-19(24)9-7-18;/h6-9,14,17,22H,4-5,10-13,15-16H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | BORVFZLHYFBTLB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|