C22H32ClN5O2 — CID 111595358
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111595358) has the molecular formula C22H32ClN5O2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111595358 |
| Molecular Formula | C22H32ClN5O2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H32ClN5O2/c1-22(2,3)19-14-25-20(30-19)15-27-21(24-4)26-13-18(28-9-11-29-12-10-28)16-5-7-17(23)8-6-16/h5-8,14,18H,9-13,15H2,1-4H3,(H2,24,26,27) |
| InChIKey | FXKPEXCSNFELQQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|