C22H33N7O — CID 111699327
N-[3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide (PubChem CID 111699327) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111699327 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | N-[3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclohexanecarboxamide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H33N7O/c1-3-20-28-26-16-29(20)13-12-24-22(23-2)25-15-17-8-7-11-19(14-17)27-21(30)18-9-5-4-6-10-18/h7-8,11,14,16,18H,3-6,9-10,12-13,15H2,1-2H3,(H,27,30)(H2,23,24,25) |
| InChIKey | TYVRVSJBFKDGNY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|