C18H26BrIN6 — CID 111700184
1-[2-(4-bromophenyl)cyclopropyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111700184) has the molecular formula C18H26BrIN6 and a molecular weight of 533.26 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)cyclopropyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111700184 |
| Molecular Formula | C18H26BrIN6 |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)NC1CC1c1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H25BrN6.HI/c1-3-17-24-22-12-25(17)10-9-21-18(20-4-2)23-16-11-15(16)13-5-7-14(19)8-6-13;/h5-8,12,15-16H,3-4,9-11H2,1-2H3,(H2,20,21,23);1H |
| InChIKey | XCLXJSPVAAVIGR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|