C18H36IN7 — CID 111707260
1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111707260) has the molecular formula C18H36IN7 and a molecular weight of 477.44 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111707260 |
| Molecular Formula | C18H36IN7 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCC(C)(C)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C18H35N7.HI/c1-7-19-17(20-9-16-22-13-23-24(16)6)21-12-18(4,5)25-10-14(2)8-15(3)11-25;/h13-15H,7-12H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | OKEDUGUMEKSBRC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|