C17H33N7O — CID 111705201
1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705201) has the molecular formula C17H33N7O and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705201 |
| Molecular Formula | C17H33N7O |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCC(C)(C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C17H33N7O/c1-7-18-16(19-8-15-21-12-22-23(15)6)20-11-17(4,5)24-9-13(2)25-14(3)10-24/h12-14H,7-11H2,1-6H3,(H2,18,19,20) |
| InChIKey | FOYGAKGSRANMBN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|