C21H34F3N5 — CID 111711515
1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111711515) has the molecular formula C21H34F3N5 and a molecular weight of 413.53 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111711515 |
| Molecular Formula | C21H34F3N5 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)ethyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCN1CCN(CCN/C(=N\C)NCCC(C)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H34F3N5/c1-4-28-12-14-29(15-13-28)11-10-27-20(25-3)26-9-8-17(2)18-6-5-7-19(16-18)21(22,23)24/h5-7,16-17H,4,8-15H2,1-3H3,(H2,25,26,27) |
| InChIKey | PAKULTCKNGPJSF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|