C19H31F3N4O2S — CID 111711707
1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111711707) has the molecular formula C19H31F3N4O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111711707 |
| Molecular Formula | C19H31F3N4O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCN(CCCN/C(=N\C)NCCC(C)c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H31F3N4O2S/c1-5-26(29(4,27)28)13-7-11-24-18(23-3)25-12-10-15(2)16-8-6-9-17(14-16)19(20,21)22/h6,8-9,14-15H,5,7,10-13H2,1-4H3,(H2,23,24,25) |
| InChIKey | GBMGCHFFVFMFNK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|