C20H29F3N4O — CID 111711609
N-cyclopropyl-4-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]butanamide (PubChem CID 111711609) has the molecular formula C20H29F3N4O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111711609 |
| Molecular Formula | C20H29F3N4O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-cyclopropyl-4-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]butanamide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCCC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H29F3N4O/c1-14(15-5-3-6-16(13-15)20(21,22)23)10-12-26-19(24-2)25-11-4-7-18(28)27-17-8-9-17/h3,5-6,13-14,17H,4,7-12H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | UMFFVIZIPZQSKL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|