C23H30N4O — CID 111721147
2-(2-morpholin-4-yl-2-phenylethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 111721147) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(2-morpholin-4-yl-2-phenylethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-(2-morpholin-4-yl-2-phenylethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 111721147 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-(2-morpholin-4-yl-2-phenylethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | N/C(=N\CC(c1ccccc1)N1CCOCC1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C23H30N4O/c24-23(26-21-12-6-10-18-7-4-5-11-20(18)21)25-17-22(19-8-2-1-3-9-19)27-13-15-28-16-14-27/h1-3,6,8-10,12,22H,4-5,7,11,13-17H2,(H3,24,25,26) |
| InChIKey | DZEYJKVATZFRME-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|