C19H30N4O2 — CID 111721649
tert-butyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-N-methylcarbamate (PubChem CID 111721649) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111721649 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | tert-butyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-N-methylcarbamate |
| SMILES | CN(CC/N=C(\N)Nc1cccc2c1CCCC2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N4O2/c1-19(2,3)25-18(24)23(4)13-12-21-17(20)22-16-11-7-9-14-8-5-6-10-15(14)16/h7,9,11H,5-6,8,10,12-13H2,1-4H3,(H3,20,21,22) |
| InChIKey | XVFKRPHVYQROTP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|