C14H32O2Si2 — CID 11173753
tert-butyl-dimethyl-[(Z,2S)-3-trimethylsilyloxypent-3-en-2-yl]oxysilane (PubChem CID 11173753) has the molecular formula C14H32O2Si2 and a molecular weight of 288.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2S)-3-trimethylsilyloxypent-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,2S)-3-trimethylsilyloxypent-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 11173753 |
| Molecular Formula | C14H32O2Si2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2S)-3-trimethylsilyloxypent-3-en-2-yl]oxysilane |
| SMILES | C/C=C(\O[Si](C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32O2Si2/c1-11-13(16-17(6,7)8)12(2)15-18(9,10)14(3,4)5/h11-12H,1-10H3/b13-11-/t12-/m0/s1 |
| InChIKey | OTYOQHSLWJMSRV-KLDSGFLGSA-N |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|