C19H35N7O — CID 111739020
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,3-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide (PubChem CID 111739020) has the molecular formula C19H35N7O and a molecular weight of 377.54 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,3-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,3-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739020 |
| Molecular Formula | C19H35N7O |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,3-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCCCN2CCOCC2)N2CCC(C)(C)C2)n1C |
| InChI | InChI=1S/C19H35N7O/c1-16-22-23-17(24(16)4)14-21-18(26-9-6-19(2,3)15-26)20-7-5-8-25-10-12-27-13-11-25/h5-15H2,1-4H3,(H,20,21) |
| InChIKey | ZBHVRUNJHPVJFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|