C21H38N8O2 — CID 111726993
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide (PubChem CID 111726993) has the molecular formula C21H38N8O2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111726993 |
| Molecular Formula | C21H38N8O2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCCCN2CCOCC2)N2CCC(N3CCOCC3)C2)n1C |
| InChI | InChI=1S/C21H38N8O2/c1-18-24-25-20(26(18)2)16-23-21(22-5-3-6-27-8-12-30-13-9-27)29-7-4-19(17-29)28-10-14-31-15-11-28/h19H,3-17H2,1-2H3,(H,22,23) |
| InChIKey | UGCPARQGWMMKHC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|