C23H31N3OS — CID 111748818
N-[2-(2-methoxyphenyl)propyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748818) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)propyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(2-methoxyphenyl)propyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748818 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[2-(2-methoxyphenyl)propyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(C)c1ccccc1OC)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C23H31N3OS/c1-18(21-11-7-8-12-22(21)27-3)15-25-23(24-2)26-14-13-19(16-26)17-28-20-9-5-4-6-10-20/h4-12,18-19H,13-17H2,1-3H3,(H,24,25) |
| InChIKey | VLDSLWFWHSJDMP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|