C15H30IN3O — CID 111756809
1-(3-butoxy-2,2-dimethylcyclobutyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111756809) has the molecular formula C15H30IN3O and a molecular weight of 395.33 g/mol. Its IUPAC name is 1-(3-butoxy-2,2-dimethylcyclobutyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-(3-butoxy-2,2-dimethylcyclobutyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111756809 |
| Molecular Formula | C15H30IN3O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(3-butoxy-2,2-dimethylcyclobutyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NC1CC(OCCCC)C1(C)C.I |
| InChI | InChI=1S/C15H29N3O.HI/c1-6-8-10-19-13-11-12(15(13,3)4)18-14(16-5)17-9-7-2;/h7,12-13H,2,6,8-11H2,1,3-5H3,(H2,16,17,18);1H |
| InChIKey | ABWHADCBQGQQHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|