C20H16N2O5 — CID 11175959
dimethyl 4,6-dimethyl-15-oxo-13,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaene-11,12-dicarboxylate (PubChem CID 11175959) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is dimethyl 4,6-dimethyl-15-oxo-13,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaene-11,12-dicarboxylate.
| Compound Name | dimethyl 4,6-dimethyl-15-oxo-13,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 11175959 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | dimethyl 4,6-dimethyl-15-oxo-13,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10,12-heptaene-11,12-dicarboxylate |
| SMILES | COC(=O)c1nn2c(=O)c3ccc(C)c4c(C)ccc(c43)c2c1C(=O)OC |
| InChI | InChI=1S/C20H16N2O5/c1-9-5-7-11-14-12(8-6-10(2)13(9)14)18(23)22-17(11)15(19(24)26-3)16(21-22)20(25)27-4/h5-8H,1-4H3 |
| InChIKey | VIOMLQMKSOYMFA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |