C12H11BrN2O4 — CID 165134241
dimethyl 7-bromo-5-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate (PubChem CID 165134241) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is dimethyl 7-bromo-5-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 7-bromo-5-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 165134241 |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | dimethyl 7-bromo-5-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1nn2c(Br)cc(C)cc2c1C(=O)OC |
| InChI | InChI=1S/C12H11BrN2O4/c1-6-4-7-9(11(16)18-2)10(12(17)19-3)14-15(7)8(13)5-6/h4-5H,1-3H3 |
| InChIKey | KGKBBFKPGCXBJF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|