C21H33N7O2 — CID 111759813
1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111759813) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111759813 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(-c2ccco2)n[nH]1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H33N7O2/c1-22-20(23-10-7-18-25-19(27-26-18)17-6-5-13-30-17)24-16-21(8-3-2-4-9-21)28-11-14-29-15-12-28/h5-6,13H,2-4,7-12,14-16H2,1H3,(H2,22,23,24)(H,25,26,27) |
| InChIKey | SKLJQESMJNEDGA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|