C19H30N6O — CID 109490572
N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490572) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490572 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCCc2nc(-c3ccco3)n[nH]2)C1 |
| InChI | InChI=1S/C19H30N6O/c1-4-9-19(2)10-6-12-25(14-19)18(20-3)21-11-8-16-22-17(24-23-16)15-7-5-13-26-15/h5,7,13H,4,6,8-12,14H2,1-3H3,(H,20,21)(H,22,23,24) |
| InChIKey | XYBQMSHBFKSIDA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|