C24H42IN5O3 — CID 111761792
1-[2-(furan-2-yl)ethyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111761792) has the molecular formula C24H42IN5O3 and a molecular weight of 575.54 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111761792 |
| Molecular Formula | C24H42IN5O3 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N/CC2(N3CCOCC3)CCCCC2)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C24H41N5O3.HI/c1-2-7-24(8-3-1,29-14-19-31-20-15-29)21-27-23(25-9-6-22-5-4-16-32-22)26-10-11-28-12-17-30-18-13-28;/h4-5,16H,1-3,6-15,17-21H2,(H2,25,26,27);1H |
| InChIKey | FVCXNZYJKRWXLS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|