C22H28N8 — CID 111766535
2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111766535) has the molecular formula C22H28N8 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111766535 |
| Molecular Formula | C22H28N8 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nnc2ccccn12)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C22H28N8/c1-17-26-18-9-3-4-10-19(18)29(17)16-8-14-25-22(23-2)24-13-7-12-21-28-27-20-11-5-6-15-30(20)21/h3-6,9-11,15H,7-8,12-14,16H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZNUSPBHOQWZXKR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|