C22H32N4O2 — CID 111775452
1-[2-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine (PubChem CID 111775452) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111775452 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCCCC1=O)NCCc1cc2ccccc2o1 |
| InChI | InChI=1S/C22H32N4O2/c1-2-23-22(24-13-8-16-26-15-7-3-4-11-21(26)27)25-14-12-19-17-18-9-5-6-10-20(18)28-19/h5-6,9-10,17H,2-4,7-8,11-16H2,1H3,(H2,23,24,25) |
| InChIKey | ZIUBYAMPFXOIKF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|