C20H25F2N5O3 — CID 11177648
tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate (PubChem CID 11177648) has the molecular formula C20H25F2N5O3 and a molecular weight of 421.45 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11177648 |
| Molecular Formula | C20H25F2N5O3 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-(3,4-difluorophenyl)-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCn2cnnc2C1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H25F2N5O3/c1-20(2,3)30-19(29)24-14(8-13-4-5-15(21)16(22)9-13)10-18(28)26-6-7-27-12-23-25-17(27)11-26/h4-5,9,12,14H,6-8,10-11H2,1-3H3,(H,24,29)/t14-/m1/s1 |
| InChIKey | JUSXVTDSBGUEOJ-CQSZACIVSA-N |
| XLogP | 2.42 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |