C26H22F3N3 — CID 11178001
7-[3-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]-1-phenyl-5-(trifluoromethyl)benzimidazole (PubChem CID 11178001) has the molecular formula C26H22F3N3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 7-[3-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]-1-phenyl-5-(trifluoromethyl)benzimidazole.
| Compound Name | 7-[3-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]-1-phenyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 11178001 |
| Molecular Formula | C26H22F3N3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 7-[3-(3,6-dihydro-2H-pyridin-1-ylmethyl)phenyl]-1-phenyl-5-(trifluoromethyl)benzimidazole |
| SMILES | FC(F)(F)c1cc(-c2cccc(CN3CC=CCC3)c2)c2c(c1)ncn2-c1ccccc1 |
| InChI | InChI=1S/C26H22F3N3/c27-26(28,29)21-15-23(20-9-7-8-19(14-20)17-31-12-5-2-6-13-31)25-24(16-21)30-18-32(25)22-10-3-1-4-11-22/h1-5,7-11,14-16,18H,6,12-13,17H2 |
| InChIKey | USFIWIRXDNXFCE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|