C17H26FN3O2 — CID 111782846
tert-butyl 2-[[ethylamino-[2-(4-fluorophenyl)ethylamino]methylidene]amino]acetate (PubChem CID 111782846) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is tert-butyl 2-[[ethylamino-[2-(4-fluorophenyl)ethylamino]methylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[ethylamino-[2-(4-fluorophenyl)ethylamino]methylidene]amino]acetate |
|---|---|
| PubChem CID | 111782846 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | tert-butyl 2-[[ethylamino-[2-(4-fluorophenyl)ethylamino]methylidene]amino]acetate |
| SMILES | CCN/C(=N\CC(=O)OC(C)(C)C)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H26FN3O2/c1-5-19-16(21-12-15(22)23-17(2,3)4)20-11-10-13-6-8-14(18)9-7-13/h6-9H,5,10-12H2,1-4H3,(H2,19,20,21) |
| InChIKey | ANTGSEXYXZBAEW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|