C19H27F3N6O4 — CID 11178652
N-hydroxy-N-[[4-methyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]formamide (PubChem CID 11178652) has the molecular formula C19H27F3N6O4 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-hydroxy-N-[[4-methyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]formamide.
| Compound Name | N-hydroxy-N-[[4-methyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]formamide |
|---|---|
| PubChem CID | 11178652 |
| Molecular Formula | C19H27F3N6O4 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-hydroxy-N-[[4-methyl-1-[[[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]formamide |
| SMILES | CC1CCC(CN(O)C=O)(C(=O)NNc2nc(N3CCOCC3)cc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C19H27F3N6O4/c1-13-2-4-18(5-3-13,11-28(31)12-29)16(30)25-26-17-23-14(19(20,21)22)10-15(24-17)27-6-8-32-9-7-27/h10,12-13,31H,2-9,11H2,1H3,(H,25,30)(H,23,24,26) |
| InChIKey | QSCHXHGFBLZGJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|