C20H29N3O3S — CID 111792565
1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 111792565) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111792565 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H29N3O3S/c1-7-21-19(22-13-20(2,3)17-9-8-10-27-17)23-14-11-15(24-4)18(26-6)16(12-14)25-5/h8-12H,7,13H2,1-6H3,(H2,21,22,23) |
| InChIKey | ZHGGKXWSXHTQKB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|