C37H41N3O5S — CID 11181250
(2S)-2-[[4-[5-(4-methoxyphenyl)-3-(4-pentylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonyl-methylamino]-3-phenylpropanoic acid (PubChem CID 11181250) has the molecular formula C37H41N3O5S and a molecular weight of 639.82 g/mol. Its IUPAC name is (2S)-2-[[4-[5-(4-methoxyphenyl)-3-(4-pentylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonyl-methylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[4-[5-(4-methoxyphenyl)-3-(4-pentylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonyl-methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11181250 |
| Molecular Formula | C37H41N3O5S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | (2S)-2-[[4-[5-(4-methoxyphenyl)-3-(4-pentylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonyl-methylamino]-3-phenylpropanoic acid |
| SMILES | CCCCCc1ccc(C2CC(c3ccc(OC)cc3)=NN2c2ccc(S(=O)(=O)N(C)[C@@H](Cc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C37H41N3O5S/c1-4-5-7-10-27-13-15-30(16-14-27)35-26-34(29-17-21-32(45-3)22-18-29)38-40(35)31-19-23-33(24-20-31)46(43,44)39(2)36(37(41)42)25-28-11-8-6-9-12-28/h6,8-9,11-24,35-36H,4-5,7,10,25-26H2,1-3H3,(H,41,42)/t35?,36-/m0/s1 |
| InChIKey | VZVPGXOQYBTWHP-UHBYFKDRSA-N |
| XLogP | 7.10 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|