C30H44N4O9SSi — CID 11181412
tert-butyl 3-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyano-4-(methanesulfonamido)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate (PubChem CID 11181412) has the molecular formula C30H44N4O9SSi and a molecular weight of 664.85 g/mol. Its IUPAC name is tert-butyl 3-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyano-4-(methanesulfonamido)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyano-4-(methanesulfonamido)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 11181412 |
| Molecular Formula | C30H44N4O9SSi |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | tert-butyl 3-[(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyano-4-(methanesulfonamido)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate |
| SMILES | Cc1cn([C@@H]2O[C@H](COCc3ccccc3)[C@@](C#N)(NS(C)(=O)=O)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)n(C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C30H44N4O9SSi/c1-20-16-33(26(36)34(24(20)35)27(37)42-28(2,3)4)25-23(43-45(9,10)29(5,6)7)30(19-31,32-44(8,38)39)22(41-25)18-40-17-21-14-12-11-13-15-21/h11-16,22-23,25,32H,17-18H2,1-10H3/t22-,23+,25-,30-/m1/s1 |
| InChIKey | PHGRCFUWLACGJF-AADRLYINSA-N |
| XLogP | 3.42 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|