C20H32N2O12S — CID 102309115
tert-butyl 3-[(2R,3R,4R,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-methylsulfonyloxyoxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate (PubChem CID 102309115) has the molecular formula C20H32N2O12S and a molecular weight of 524.55 g/mol. Its IUPAC name is tert-butyl 3-[(2R,3R,4R,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-methylsulfonyloxyoxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2R,3R,4R,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-methylsulfonyloxyoxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 102309115 |
| Molecular Formula | C20H32N2O12S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | tert-butyl 3-[(2R,3R,4R,5R)-4-(methoxymethoxy)-5-(methoxymethoxymethyl)-3-methylsulfonyloxyoxolan-2-yl]-5-methyl-2,6-dioxopyrimidine-1-carboxylate |
| SMILES | COCOC[C@H]1O[C@@H](n2cc(C)c(=O)n(C(=O)OC(C)(C)C)c2=O)[C@H](OS(C)(=O)=O)[C@@H]1OCOC |
| InChI | InChI=1S/C20H32N2O12S/c1-12-8-21(18(24)22(16(12)23)19(25)33-20(2,3)4)17-15(34-35(7,26)27)14(31-11-29-6)13(32-17)9-30-10-28-5/h8,13-15,17H,9-11H2,1-7H3/t13-,14-,15-,17-/m1/s1 |
| InChIKey | WRUGPQUMNCWJKY-KCYZZUKISA-N |
| XLogP | -0.05 |
| TPSA | 159.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|