C14H15F3N4S — CID 111815272
1-(3,5-dimethylphenyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111815272) has the molecular formula C14H15F3N4S and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111815272 |
| Molecular Formula | C14H15F3N4S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C14H15F3N4S/c1-8-3-9(2)5-10(4-8)20-13(18)19-6-12-21-11(7-22-12)14(15,16)17/h3-5,7H,6H2,1-2H3,(H3,18,19,20) |
| InChIKey | HTXQSLZJCTUGNE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|