C9H14F3IN4S — CID 111815205
1-propan-2-yl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111815205) has the molecular formula C9H14F3IN4S and a molecular weight of 394.20 g/mol. Its IUPAC name is 1-propan-2-yl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-propan-2-yl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111815205 |
| Molecular Formula | C9H14F3IN4S |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-propan-2-yl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/Cc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C9H13F3N4S.HI/c1-5(2)15-8(13)14-3-7-16-6(4-17-7)9(10,11)12;/h4-5H,3H2,1-2H3,(H3,13,14,15);1H |
| InChIKey | ALRBGWOLZCOYNH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|