C16H23IN4S — CID 111817493
2-benzyl-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 111817493) has the molecular formula C16H23IN4S and a molecular weight of 430.36 g/mol. Its IUPAC name is 2-benzyl-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-benzyl-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111817493 |
| Molecular Formula | C16H23IN4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-benzyl-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | Cc1nc(C)c(CN/C(=N/Cc2ccccc2)N(C)C)s1.I |
| InChI | InChI=1S/C16H22N4S.HI/c1-12-15(21-13(2)19-12)11-18-16(20(3)4)17-10-14-8-6-5-7-9-14;/h5-9H,10-11H2,1-4H3,(H,17,18);1H |
| InChIKey | DBEYIJTVHOAQSA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|