C11H16F3IN4OS — CID 111820871
N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111820871) has the molecular formula C11H16F3IN4OS and a molecular weight of 436.24 g/mol. Its IUPAC name is N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111820871 |
| Molecular Formula | C11H16F3IN4OS |
| Molecular Weight | 436.24 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCc1nc(C(F)(F)F)cs1)N1CCOCC1 |
| InChI | InChI=1S/C11H15F3N4OS.HI/c12-11(13,14)8-7-20-9(17-8)1-2-16-10(15)18-3-5-19-6-4-18;/h7H,1-6H2,(H2,15,16);1H |
| InChIKey | YDLXTTLHDVAQOB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|