C17H38IN3O — CID 111822922
2-(2,2-diethyl-4-hydroxybutyl)-1-(6-methylheptan-2-yl)guanidine;hydroiodide (PubChem CID 111822922) has the molecular formula C17H38IN3O and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-(6-methylheptan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(6-methylheptan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111822922 |
| Molecular Formula | C17H38IN3O |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(6-methylheptan-2-yl)guanidine;hydroiodide |
| SMILES | CCC(CC)(CCO)C/N=C(\N)NC(C)CCCC(C)C.I |
| InChI | InChI=1S/C17H37N3O.HI/c1-6-17(7-2,11-12-21)13-19-16(18)20-15(5)10-8-9-14(3)4;/h14-15,21H,6-13H2,1-5H3,(H3,18,19,20);1H |
| InChIKey | YUFSKOBLLYYTTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|