C17H20ClFIN3O3S — CID 111824671
1-(3-chloro-4-methoxyphenyl)-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111824671) has the molecular formula C17H20ClFIN3O3S and a molecular weight of 527.79 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111824671 |
| Molecular Formula | C17H20ClFIN3O3S |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2cc(F)ccc2CS(C)(=O)=O)cc1Cl.I |
| InChI | InChI=1S/C17H19ClFN3O3S.HI/c1-25-16-6-5-14(8-15(16)18)22-17(20)21-9-12-7-13(19)4-3-11(12)10-26(2,23)24;/h3-8H,9-10H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | ZKQCADBLHYIUQQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|