C13H21FIN3O2S — CID 111824705
2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-1-propylguanidine;hydroiodide (PubChem CID 111824705) has the molecular formula C13H21FIN3O2S and a molecular weight of 429.30 g/mol. Its IUPAC name is 2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111824705 |
| Molecular Formula | C13H21FIN3O2S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/Cc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C13H20FN3O2S.HI/c1-3-6-16-13(15)17-8-11-7-12(14)5-4-10(11)9-20(2,18)19;/h4-5,7H,3,6,8-9H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | LSCCXFZNYNOSIV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|